C17H23NO2 — CID 70761370
(3R,4S)-1-[[4-(3-hydroxyprop-1-ynyl)phenyl]methyl]-3,4-dimethylpiperidin-4-ol (PubChem CID 70761370) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (3R,4S)-1-[[4-(3-hydroxyprop-1-ynyl)phenyl]methyl]-3,4-dimethylpiperidin-4-ol.
| Compound Name | (3R,4S)-1-[[4-(3-hydroxyprop-1-ynyl)phenyl]methyl]-3,4-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 70761370 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (3R,4S)-1-[[4-(3-hydroxyprop-1-ynyl)phenyl]methyl]-3,4-dimethylpiperidin-4-ol |
| SMILES | C[C@@H]1CN(Cc2ccc(C#CCO)cc2)CC[C@]1(C)O |
| InChI | InChI=1S/C17H23NO2/c1-14-12-18(10-9-17(14,2)20)13-16-7-5-15(6-8-16)4-3-11-19/h5-8,14,19-20H,9-13H2,1-2H3/t14-,17+/m1/s1 |
| InChIKey | ILDJFUBEFKYFKZ-PBHICJAKSA-N |
| XLogP | 1.62 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|