C15H13N5 — CID 70761562
2-methyl-6-(1-methylpyrrolo[2,3-b]pyridin-4-yl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 70761562) has the molecular formula C15H13N5 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-methyl-6-(1-methylpyrrolo[2,3-b]pyridin-4-yl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-methyl-6-(1-methylpyrrolo[2,3-b]pyridin-4-yl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 70761562 |
| Molecular Formula | C15H13N5 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-methyl-6-(1-methylpyrrolo[2,3-b]pyridin-4-yl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1nc2ccc(-c3ccnc4c3ccn4C)cn2n1 |
| InChI | InChI=1S/C15H13N5/c1-10-17-14-4-3-11(9-20(14)18-10)12-5-7-16-15-13(12)6-8-19(15)2/h3-9H,1-2H3 |
| InChIKey | MDESDUBMLIKMJF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|