C12H22N2O2 — CID 7076240
(3S,6S)-3,6-bis[(2S)-butan-2-yl]piperazine-2,5-dione (PubChem CID 7076240) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is (3S,6S)-3,6-bis[(2S)-butan-2-yl]piperazine-2,5-dione.
| Compound Name | (3S,6S)-3,6-bis[(2S)-butan-2-yl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 7076240 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | (3S,6S)-3,6-bis[(2S)-butan-2-yl]piperazine-2,5-dione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H]([C@@H](C)CC)NC1=O |
| InChI | InChI=1S/C12H22N2O2/c1-5-7(3)9-11(15)14-10(8(4)6-2)12(16)13-9/h7-10H,5-6H2,1-4H3,(H,13,16)(H,14,15)/t7-,8-,9-,10-/m0/s1 |
| InChIKey | ZRLVJNQOEORYIS-XKNYDFJKSA-N |
| XLogP | 1.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |