C21H31N3O — CID 70762800
1-[(1-ethylindol-6-yl)methyl]-3-(piperidin-1-ylmethyl)pyrrolidin-3-ol (PubChem CID 70762800) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is 1-[(1-ethylindol-6-yl)methyl]-3-(piperidin-1-ylmethyl)pyrrolidin-3-ol.
| Compound Name | 1-[(1-ethylindol-6-yl)methyl]-3-(piperidin-1-ylmethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 70762800 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | 1-[(1-ethylindol-6-yl)methyl]-3-(piperidin-1-ylmethyl)pyrrolidin-3-ol |
| SMILES | CCn1ccc2ccc(CN3CCC(O)(CN4CCCCC4)C3)cc21 |
| InChI | InChI=1S/C21H31N3O/c1-2-24-12-8-19-7-6-18(14-20(19)24)15-23-13-9-21(25,17-23)16-22-10-4-3-5-11-22/h6-8,12,14,25H,2-5,9-11,13,15-17H2,1H3 |
| InChIKey | QPZXEYUZIIMYGA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 31.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |