C20H19N3O3 — CID 70762974
(4-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methyl-4-oxa-2,5-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraen-8-yl)methanone (PubChem CID 70762974) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is (4-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methyl-4-oxa-2,5-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraen-8-yl)methanone.
| Compound Name | (4-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methyl-4-oxa-2,5-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraen-8-yl)methanone |
|---|---|
| PubChem CID | 70762974 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (4-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methyl-4-oxa-2,5-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraen-8-yl)methanone |
| SMILES | Cc1noc2nc3c(c(C(=O)N4Cc5ccccc5C(O)C4)c12)CCC3 |
| InChI | InChI=1S/C20H19N3O3/c1-11-17-18(14-7-4-8-15(14)21-19(17)26-22-11)20(25)23-9-12-5-2-3-6-13(12)16(24)10-23/h2-3,5-6,16,24H,4,7-10H2,1H3 |
| InChIKey | DFQWSIJDAYZVEL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |