About 6-(2,5-dimethylfuran-3-yl)-7-methyl-2-(piperazine-1-carbonyl)imidazo[1,2-a]pyrazin-8-one
6-(2,5-dimethylfuran-3-yl)-7-methyl-2-(piperazine-1-carbonyl)imidazo[1,2-a]pyrazin-8-one (PubChem CID 70763171) has the molecular formula C18H21N5O3
and a molecular weight of 355.40 g/mol. Its IUPAC name is 6-(2,5-dimethylfuran-3-yl)-7-methyl-2-(piperazine-1-carbonyl)imidazo[1,2-a]pyrazin-8-one.
Molecular Properties
| Compound Name | 6-(2,5-dimethylfuran-3-yl)-7-methyl-2-(piperazine-1-carbonyl)imidazo[1,2-a]pyrazin-8-one |
| PubChem CID | 70763171 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 6-(2,5-dimethylfuran-3-yl)-7-methyl-2-(piperazine-1-carbonyl)imidazo[1,2-a]pyrazin-8-one |
| SMILES | Cc1cc(-c2cn3cc(C(=O)N4CCNCC4)nc3c(=O)n2C)c(C)o1 |
| InChI | InChI=1S/C18H21N5O3/c1-11-8-13(12(2)26-11)15-10-23-9-14(20-16(23)18(25)21(15)3)17(24)22-6-4-19-5-7-22/h8-10,19H,4-7H2,1-3H3 |
| InChIKey | LPKBTZUDQKQDCB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(2,5-dimethylfuran-3-yl)-7-methyl-2-(piperazine-1-carbonyl)imidazo[1,2-a]pyrazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-dimethylfuran-3-yl)-7-methyl-2-(piperazine-1-carbonyl)imidazo[1,2-a]pyrazin-8-one?
The IUPAC name of 6-(2,5-dimethylfuran-3-yl)-7-methyl-2-(piperazine-1-carbonyl)imidazo[1,2-a]pyrazin-8-one (CID 70763171) is 6-(2,5-dimethylfuran-3-yl)-7-methyl-2-(piperazine-1-carbonyl)imidazo[1,2-a]pyrazin-8-one.
What is the SMILES notation for 6-(2,5-dimethylfuran-3-yl)-7-methyl-2-(piperazine-1-carbonyl)imidazo[1,2-a]pyrazin-8-one?
The canonical SMILES for 6-(2,5-dimethylfuran-3-yl)-7-methyl-2-(piperazine-1-carbonyl)imidazo[1,2-a]pyrazin-8-one is Cc1cc(-c2cn3cc(C(=O)N4CCNCC4)nc3c(=O)n2C)c(C)o1.
What is the InChIKey of 6-(2,5-dimethylfuran-3-yl)-7-methyl-2-(piperazine-1-carbonyl)imidazo[1,2-a]pyrazin-8-one?
The InChIKey is LPKBTZUDQKQDCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N5O3/c1-11-8-13(12(2)26-11)15-10-23-9-14(20-16(23)18(25)21(15)3)17(24)22-6-4-19-5-7-22/h8-10,19H,4-7H2,1-3H3.
What are the key properties of 6-(2,5-dimethylfuran-3-yl)-7-methyl-2-(piperazine-1-carbonyl)imidazo[1,2-a]pyrazin-8-one?
6-(2,5-dimethylfuran-3-yl)-7-methyl-2-(piperazine-1-carbonyl)imidazo[1,2-a]pyrazin-8-one has a molecular weight of 355.40 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dimethylfuran-3-yl)-7-methyl-2-(piperazine-1-carbonyl)imidazo[1,2-a]pyrazin-8-one is sourced from PubChem (CID 70763171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).