About 1-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid
1-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid (PubChem CID 70764157) has the molecular formula C18H23NO5
and a molecular weight of 333.38 g/mol. Its IUPAC name is 1-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid |
| PubChem CID | 70764157 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid |
| SMILES | C=CCC1(C(=O)O)CCCN(Cc2cc3c(cc2OC)OCO3)C1 |
| InChI | InChI=1S/C18H23NO5/c1-3-5-18(17(20)21)6-4-7-19(11-18)10-13-8-15-16(24-12-23-15)9-14(13)22-2/h3,8-9H,1,4-7,10-12H2,2H3,(H,20,21) |
| InChIKey | YYOSWCRECCJVBS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid?
The IUPAC name of 1-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid (CID 70764157) is 1-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid.
What is the SMILES notation for 1-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid?
The canonical SMILES for 1-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid is C=CCC1(C(=O)O)CCCN(Cc2cc3c(cc2OC)OCO3)C1.
What is the InChIKey of 1-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid?
The InChIKey is YYOSWCRECCJVBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO5/c1-3-5-18(17(20)21)6-4-7-19(11-18)10-13-8-15-16(24-12-23-15)9-14(13)22-2/h3,8-9H,1,4-7,10-12H2,2H3,(H,20,21).
What are the key properties of 1-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid?
1-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid has a molecular weight of 333.38 g/mol, XLogP of 2.67, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid is sourced from PubChem (CID 70764157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).