C15H20N2O2 — CID 70764508
N-[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-5-cyclopropyl-1,3-oxazole-4-carboxamide (PubChem CID 70764508) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-5-cyclopropyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-5-cyclopropyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 70764508 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-5-cyclopropyl-1,3-oxazole-4-carboxamide |
| SMILES | O=C(N[C@H]1CC[C@@H]2CCC[C@@H]21)c1ncoc1C1CC1 |
| InChI | InChI=1S/C15H20N2O2/c18-15(13-14(10-4-5-10)19-8-16-13)17-12-7-6-9-2-1-3-11(9)12/h8-12H,1-7H2,(H,17,18)/t9-,11-,12-/m0/s1 |
| InChIKey | CROAWYGOLZOVBH-DLOVCJGASA-N |
| XLogP | 2.86 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |