About 2-[1-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]imidazol-2-yl]pyridine
2-[1-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]imidazol-2-yl]pyridine (PubChem CID 70764923) has the molecular formula C13H14N6
and a molecular weight of 254.30 g/mol. Its IUPAC name is 2-[1-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]imidazol-2-yl]pyridine.
Molecular Properties
| Compound Name | 2-[1-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]imidazol-2-yl]pyridine |
| PubChem CID | 70764923 |
| Molecular Formula | C13H14N6 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-[1-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]imidazol-2-yl]pyridine |
| SMILES | Cn1ncnc1CCn1ccnc1-c1ccccn1 |
| InChI | InChI=1S/C13H14N6/c1-18-12(16-10-17-18)5-8-19-9-7-15-13(19)11-4-2-3-6-14-11/h2-4,6-7,9-10H,5,8H2,1H3 |
| InChIKey | XEGZBGQTVDKTNU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[1-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]imidazol-2-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]imidazol-2-yl]pyridine?
The IUPAC name of 2-[1-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]imidazol-2-yl]pyridine (CID 70764923) is 2-[1-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]imidazol-2-yl]pyridine.
What is the SMILES notation for 2-[1-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]imidazol-2-yl]pyridine?
The canonical SMILES for 2-[1-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]imidazol-2-yl]pyridine is Cn1ncnc1CCn1ccnc1-c1ccccn1.
What is the InChIKey of 2-[1-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]imidazol-2-yl]pyridine?
The InChIKey is XEGZBGQTVDKTNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N6/c1-18-12(16-10-17-18)5-8-19-9-7-15-13(19)11-4-2-3-6-14-11/h2-4,6-7,9-10H,5,8H2,1H3.
What are the key properties of 2-[1-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]imidazol-2-yl]pyridine?
2-[1-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]imidazol-2-yl]pyridine has a molecular weight of 254.30 g/mol, XLogP of 1.32, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]imidazol-2-yl]pyridine is sourced from PubChem (CID 70764923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).