C19H28N4O4 — CID 70765343
5-[2-[(4aS,8aR)-1-(3-methylbutyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione (PubChem CID 70765343) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is 5-[2-[(4aS,8aR)-1-(3-methylbutyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[2-[(4aS,8aR)-1-(3-methylbutyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70765343 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 5-[2-[(4aS,8aR)-1-(3-methylbutyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione |
| SMILES | CC(C)CCN1C(=O)CC[C@H]2CN(C(=O)Cc3c[nH]c(=O)[nH]c3=O)CC[C@H]21 |
| InChI | InChI=1S/C19H28N4O4/c1-12(2)5-8-23-15-6-7-22(11-13(15)3-4-16(23)24)17(25)9-14-10-20-19(27)21-18(14)26/h10,12-13,15H,3-9,11H2,1-2H3,(H2,20,21,26,27)/t13-,15+/m0/s1 |
| InChIKey | RVMMEEXLUPCULY-DZGCQCFKSA-N |
| XLogP | 0.49 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |