C20H28N4OS — CID 70765753
N-[[5-(2-methylpropyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-2-methylsulfanylbenzamide (PubChem CID 70765753) has the molecular formula C20H28N4OS and a molecular weight of 372.54 g/mol. Its IUPAC name is N-[[5-(2-methylpropyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-2-methylsulfanylbenzamide.
| Compound Name | N-[[5-(2-methylpropyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 70765753 |
| Molecular Formula | C20H28N4OS |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[[5-(2-methylpropyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-2-methylsulfanylbenzamide |
| SMILES | CSc1ccccc1C(=O)NCc1cc2n(n1)CCCN(CC(C)C)C2 |
| InChI | InChI=1S/C20H28N4OS/c1-15(2)13-23-9-6-10-24-17(14-23)11-16(22-24)12-21-20(25)18-7-4-5-8-19(18)26-3/h4-5,7-8,11,15H,6,9-10,12-14H2,1-3H3,(H,21,25) |
| InChIKey | SIBJDAWEJHITIU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |