C23H26FN3O2 — CID 70766306
[1-[[3-(2-fluoro-4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]piperidin-3-yl]methanol (PubChem CID 70766306) has the molecular formula C23H26FN3O2 and a molecular weight of 395.48 g/mol. Its IUPAC name is [1-[[3-(2-fluoro-4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]piperidin-3-yl]methanol.
| Compound Name | [1-[[3-(2-fluoro-4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 70766306 |
| Molecular Formula | C23H26FN3O2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | [1-[[3-(2-fluoro-4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]piperidin-3-yl]methanol |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2CN2CCCC(CO)C2)c(F)c1 |
| InChI | InChI=1S/C23H26FN3O2/c1-29-20-9-10-21(22(24)12-20)23-18(14-26-11-5-6-17(13-26)16-28)15-27(25-23)19-7-3-2-4-8-19/h2-4,7-10,12,15,17,28H,5-6,11,13-14,16H2,1H3 |
| InChIKey | RXJGPELSCZSBGC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |