About 3-(4-chlorophenyl)-5,6-dimethylfuro[3,2-g]chromen-7-one
3-(4-chlorophenyl)-5,6-dimethylfuro[3,2-g]chromen-7-one (PubChem CID 707670) has the molecular formula C19H13ClO3
and a molecular weight of 324.76 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5,6-dimethylfuro[3,2-g]chromen-7-one.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-5,6-dimethylfuro[3,2-g]chromen-7-one |
| PubChem CID | 707670 |
| Molecular Formula | C19H13ClO3 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 3-(4-chlorophenyl)-5,6-dimethylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1c(C)c2cc3c(-c4ccc(Cl)cc4)coc3cc2oc1=O |
| InChI | InChI=1S/C19H13ClO3/c1-10-11(2)19(21)23-18-8-17-15(7-14(10)18)16(9-22-17)12-3-5-13(20)6-4-12/h3-9H,1-2H3 |
| InChIKey | UFJVVFFKQIOFJU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)-5,6-dimethylfuro[3,2-g]chromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-5,6-dimethylfuro[3,2-g]chromen-7-one?
The IUPAC name of 3-(4-chlorophenyl)-5,6-dimethylfuro[3,2-g]chromen-7-one (CID 707670) is 3-(4-chlorophenyl)-5,6-dimethylfuro[3,2-g]chromen-7-one.
What is the SMILES notation for 3-(4-chlorophenyl)-5,6-dimethylfuro[3,2-g]chromen-7-one?
The canonical SMILES for 3-(4-chlorophenyl)-5,6-dimethylfuro[3,2-g]chromen-7-one is Cc1c(C)c2cc3c(-c4ccc(Cl)cc4)coc3cc2oc1=O.
What is the InChIKey of 3-(4-chlorophenyl)-5,6-dimethylfuro[3,2-g]chromen-7-one?
The InChIKey is UFJVVFFKQIOFJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClO3/c1-10-11(2)19(21)23-18-8-17-15(7-14(10)18)16(9-22-17)12-3-5-13(20)6-4-12/h3-9H,1-2H3.
What are the key properties of 3-(4-chlorophenyl)-5,6-dimethylfuro[3,2-g]chromen-7-one?
3-(4-chlorophenyl)-5,6-dimethylfuro[3,2-g]chromen-7-one has a molecular weight of 324.76 g/mol, XLogP of 5.48, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-5,6-dimethylfuro[3,2-g]chromen-7-one is sourced from PubChem (CID 707670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).