About N-benzyl-5-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]pyrimidin-2-amine
N-benzyl-5-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]pyrimidin-2-amine (PubChem CID 70767133) has the molecular formula C18H24N4O2S
and a molecular weight of 360.48 g/mol. Its IUPAC name is N-benzyl-5-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-benzyl-5-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]pyrimidin-2-amine |
| PubChem CID | 70767133 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-benzyl-5-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]pyrimidin-2-amine |
| SMILES | CCN(Cc1cnc(NCc2ccccc2)nc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H24N4O2S/c1-2-22(17-8-9-25(23,24)14-17)13-16-11-20-18(21-12-16)19-10-15-6-4-3-5-7-15/h3-7,11-12,17H,2,8-10,13-14H2,1H3,(H,19,20,21) |
| InChIKey | RPKYAKWBILZCOP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-benzyl-5-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-5-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]pyrimidin-2-amine?
The IUPAC name of N-benzyl-5-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]pyrimidin-2-amine (CID 70767133) is N-benzyl-5-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]pyrimidin-2-amine.
What is the SMILES notation for N-benzyl-5-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]pyrimidin-2-amine?
The canonical SMILES for N-benzyl-5-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]pyrimidin-2-amine is CCN(Cc1cnc(NCc2ccccc2)nc1)C1CCS(=O)(=O)C1.
What is the InChIKey of N-benzyl-5-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]pyrimidin-2-amine?
The InChIKey is RPKYAKWBILZCOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O2S/c1-2-22(17-8-9-25(23,24)14-17)13-16-11-20-18(21-12-16)19-10-15-6-4-3-5-7-15/h3-7,11-12,17H,2,8-10,13-14H2,1H3,(H,19,20,21).
What are the key properties of N-benzyl-5-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]pyrimidin-2-amine?
N-benzyl-5-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]pyrimidin-2-amine has a molecular weight of 360.48 g/mol, XLogP of 2.10, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-5-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]pyrimidin-2-amine is sourced from PubChem (CID 70767133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).