C19H30N6O2 — CID 70767329
(4aS,8aR)-6-[2-(2-amino-4,6-dimethylpyrimidin-5-yl)acetyl]-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 70767329) has the molecular formula C19H30N6O2 and a molecular weight of 374.49 g/mol. Its IUPAC name is (4aS,8aR)-6-[2-(2-amino-4,6-dimethylpyrimidin-5-yl)acetyl]-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-[2-(2-amino-4,6-dimethylpyrimidin-5-yl)acetyl]-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 70767329 |
| Molecular Formula | C19H30N6O2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | (4aS,8aR)-6-[2-(2-amino-4,6-dimethylpyrimidin-5-yl)acetyl]-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CNCCN1C(=O)CC[C@H]2CN(C(=O)Cc3c(C)nc(N)nc3C)CC[C@H]21 |
| InChI | InChI=1S/C19H30N6O2/c1-12-15(13(2)23-19(20)22-12)10-18(27)24-8-6-16-14(11-24)4-5-17(26)25(16)9-7-21-3/h14,16,21H,4-11H2,1-3H3,(H2,20,22,23)/t14-,16+/m0/s1 |
| InChIKey | LCFGRIVOXZRDNO-GOEBONIOSA-N |
| XLogP | 0.28 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |