C15H21F3N4O — CID 70767573
3-(piperidin-1-ylmethyl)-1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-3-ol (PubChem CID 70767573) has the molecular formula C15H21F3N4O and a molecular weight of 330.35 g/mol. Its IUPAC name is 3-(piperidin-1-ylmethyl)-1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-3-ol.
| Compound Name | 3-(piperidin-1-ylmethyl)-1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 70767573 |
| Molecular Formula | C15H21F3N4O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 3-(piperidin-1-ylmethyl)-1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-3-ol |
| SMILES | OC1(CN2CCCCC2)CCN(c2nccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C15H21F3N4O/c16-15(17,18)12-4-6-19-13(20-12)22-9-5-14(23,11-22)10-21-7-2-1-3-8-21/h4,6,23H,1-3,5,7-11H2 |
| InChIKey | JXCBAJOYGFSRBR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |