C17H21N3O4S — CID 70768359
3-[3-(1-ethylimidazol-2-yl)piperidin-1-yl]sulfonylbenzoic acid (PubChem CID 70768359) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is 3-[3-(1-ethylimidazol-2-yl)piperidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 3-[3-(1-ethylimidazol-2-yl)piperidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 70768359 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 3-[3-(1-ethylimidazol-2-yl)piperidin-1-yl]sulfonylbenzoic acid |
| SMILES | CCn1ccnc1C1CCCN(S(=O)(=O)c2cccc(C(=O)O)c2)C1 |
| InChI | InChI=1S/C17H21N3O4S/c1-2-19-10-8-18-16(19)14-6-4-9-20(12-14)25(23,24)15-7-3-5-13(11-15)17(21)22/h3,5,7-8,10-11,14H,2,4,6,9,12H2,1H3,(H,21,22) |
| InChIKey | OQMPTOBLEZVURE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |