About 2-[2-[2-(1,3-thiazol-4-yl)ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid
2-[2-[2-(1,3-thiazol-4-yl)ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid (PubChem CID 70768554) has the molecular formula C15H13N5O2S
and a molecular weight of 327.37 g/mol. Its IUPAC name is 2-[2-[2-(1,3-thiazol-4-yl)ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[2-[2-(1,3-thiazol-4-yl)ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid |
| PubChem CID | 70768554 |
| Molecular Formula | C15H13N5O2S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-[2-[2-(1,3-thiazol-4-yl)ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(-c2ccnc(NCCc3cscn3)n2)c1 |
| InChI | InChI=1S/C15H13N5O2S/c21-14(22)10-1-4-16-13(7-10)12-3-6-18-15(20-12)17-5-2-11-8-23-9-19-11/h1,3-4,6-9H,2,5H2,(H,21,22)(H,17,18,20) |
| InChIKey | PZDVPAQBCKORIP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[2-[2-(1,3-thiazol-4-yl)ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(1,3-thiazol-4-yl)ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid?
The IUPAC name of 2-[2-[2-(1,3-thiazol-4-yl)ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid (CID 70768554) is 2-[2-[2-(1,3-thiazol-4-yl)ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid.
What is the SMILES notation for 2-[2-[2-(1,3-thiazol-4-yl)ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid?
The canonical SMILES for 2-[2-[2-(1,3-thiazol-4-yl)ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid is O=C(O)c1ccnc(-c2ccnc(NCCc3cscn3)n2)c1.
What is the InChIKey of 2-[2-[2-(1,3-thiazol-4-yl)ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid?
The InChIKey is PZDVPAQBCKORIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N5O2S/c21-14(22)10-1-4-16-13(7-10)12-3-6-18-15(20-12)17-5-2-11-8-23-9-19-11/h1,3-4,6-9H,2,5H2,(H,21,22)(H,17,18,20).
What are the key properties of 2-[2-[2-(1,3-thiazol-4-yl)ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid?
2-[2-[2-(1,3-thiazol-4-yl)ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid has a molecular weight of 327.37 g/mol, XLogP of 2.35, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(1,3-thiazol-4-yl)ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid is sourced from PubChem (CID 70768554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).