C15H21N3O2S2 — CID 70768696
1-(1-methylpyrazol-4-yl)sulfonyl-2-(2-thiophen-2-ylethyl)piperidine (PubChem CID 70768696) has the molecular formula C15H21N3O2S2 and a molecular weight of 339.49 g/mol. Its IUPAC name is 1-(1-methylpyrazol-4-yl)sulfonyl-2-(2-thiophen-2-ylethyl)piperidine.
| Compound Name | 1-(1-methylpyrazol-4-yl)sulfonyl-2-(2-thiophen-2-ylethyl)piperidine |
|---|---|
| PubChem CID | 70768696 |
| Molecular Formula | C15H21N3O2S2 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 1-(1-methylpyrazol-4-yl)sulfonyl-2-(2-thiophen-2-ylethyl)piperidine |
| SMILES | Cn1cc(S(=O)(=O)N2CCCCC2CCc2cccs2)cn1 |
| InChI | InChI=1S/C15H21N3O2S2/c1-17-12-15(11-16-17)22(19,20)18-9-3-2-5-13(18)7-8-14-6-4-10-21-14/h4,6,10-13H,2-3,5,7-9H2,1H3 |
| InChIKey | OGTRRCFUUZAFEB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |