C19H31N7O — CID 70768813
3-[[5-[(2-butyl-1H-imidazol-5-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-1,1-dimethylurea (PubChem CID 70768813) has the molecular formula C19H31N7O and a molecular weight of 373.51 g/mol. Its IUPAC name is 3-[[5-[(2-butyl-1H-imidazol-5-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-1,1-dimethylurea.
| Compound Name | 3-[[5-[(2-butyl-1H-imidazol-5-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 70768813 |
| Molecular Formula | C19H31N7O |
| Molecular Weight | 373.51 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 3-[[5-[(2-butyl-1H-imidazol-5-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-1,1-dimethylurea |
| SMILES | CCCCc1ncc(CN2CCCn3nc(CNC(=O)N(C)C)cc3C2)[nH]1 |
| InChI | InChI=1S/C19H31N7O/c1-4-5-7-18-20-12-16(22-18)13-25-8-6-9-26-17(14-25)10-15(23-26)11-21-19(27)24(2)3/h10,12H,4-9,11,13-14H2,1-3H3,(H,20,22)(H,21,27) |
| InChIKey | LUAZHYGOZKMCJT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |