About 6-[[4-(2-pyridin-2-ylethyl)piperazin-1-yl]methyl]-1,4-oxazepan-6-ol
6-[[4-(2-pyridin-2-ylethyl)piperazin-1-yl]methyl]-1,4-oxazepan-6-ol (PubChem CID 70769565) has the molecular formula C17H28N4O2
and a molecular weight of 320.44 g/mol. Its IUPAC name is 6-[[4-(2-pyridin-2-ylethyl)piperazin-1-yl]methyl]-1,4-oxazepan-6-ol.
Molecular Properties
| Compound Name | 6-[[4-(2-pyridin-2-ylethyl)piperazin-1-yl]methyl]-1,4-oxazepan-6-ol |
| PubChem CID | 70769565 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 6-[[4-(2-pyridin-2-ylethyl)piperazin-1-yl]methyl]-1,4-oxazepan-6-ol |
| SMILES | OC1(CN2CCN(CCc3ccccn3)CC2)CNCCOC1 |
| InChI | InChI=1S/C17H28N4O2/c22-17(13-18-6-12-23-15-17)14-21-10-8-20(9-11-21)7-4-16-3-1-2-5-19-16/h1-3,5,18,22H,4,6-15H2 |
| InChIKey | DRIPUGIVCLQEMJ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 60.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[[4-(2-pyridin-2-ylethyl)piperazin-1-yl]methyl]-1,4-oxazepan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[4-(2-pyridin-2-ylethyl)piperazin-1-yl]methyl]-1,4-oxazepan-6-ol?
The IUPAC name of 6-[[4-(2-pyridin-2-ylethyl)piperazin-1-yl]methyl]-1,4-oxazepan-6-ol (CID 70769565) is 6-[[4-(2-pyridin-2-ylethyl)piperazin-1-yl]methyl]-1,4-oxazepan-6-ol.
What is the SMILES notation for 6-[[4-(2-pyridin-2-ylethyl)piperazin-1-yl]methyl]-1,4-oxazepan-6-ol?
The canonical SMILES for 6-[[4-(2-pyridin-2-ylethyl)piperazin-1-yl]methyl]-1,4-oxazepan-6-ol is OC1(CN2CCN(CCc3ccccn3)CC2)CNCCOC1.
What is the InChIKey of 6-[[4-(2-pyridin-2-ylethyl)piperazin-1-yl]methyl]-1,4-oxazepan-6-ol?
The InChIKey is DRIPUGIVCLQEMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N4O2/c22-17(13-18-6-12-23-15-17)14-21-10-8-20(9-11-21)7-4-16-3-1-2-5-19-16/h1-3,5,18,22H,4,6-15H2.
What are the key properties of 6-[[4-(2-pyridin-2-ylethyl)piperazin-1-yl]methyl]-1,4-oxazepan-6-ol?
6-[[4-(2-pyridin-2-ylethyl)piperazin-1-yl]methyl]-1,4-oxazepan-6-ol has a molecular weight of 320.44 g/mol, XLogP of -0.41, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[4-(2-pyridin-2-ylethyl)piperazin-1-yl]methyl]-1,4-oxazepan-6-ol is sourced from PubChem (CID 70769565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).