C23H24N4O — CID 70769742
[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-(3,5-dimethyl-1H-indol-2-yl)methanone (PubChem CID 70769742) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)piperidin-1-yl]-(3,5-dimethyl-1H-indol-2-yl)methanone.
| Compound Name | [3-(1H-benzimidazol-2-yl)piperidin-1-yl]-(3,5-dimethyl-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 70769742 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)piperidin-1-yl]-(3,5-dimethyl-1H-indol-2-yl)methanone |
| SMILES | Cc1ccc2[nH]c(C(=O)N3CCCC(c4nc5ccccc5[nH]4)C3)c(C)c2c1 |
| InChI | InChI=1S/C23H24N4O/c1-14-9-10-18-17(12-14)15(2)21(24-18)23(28)27-11-5-6-16(13-27)22-25-19-7-3-4-8-20(19)26-22/h3-4,7-10,12,16,24H,5-6,11,13H2,1-2H3,(H,25,26) |
| InChIKey | HYYCHVKLWDZAFH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|