About N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-1-propan-2-ylpyrazole-4-carboxamide
N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-1-propan-2-ylpyrazole-4-carboxamide (PubChem CID 70769764) has the molecular formula C13H20N6O
and a molecular weight of 276.34 g/mol. Its IUPAC name is N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-1-propan-2-ylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-1-propan-2-ylpyrazole-4-carboxamide |
| PubChem CID | 70769764 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-1-propan-2-ylpyrazole-4-carboxamide |
| SMILES | CCn1cnnc1CCNC(=O)c1cnn(C(C)C)c1 |
| InChI | InChI=1S/C13H20N6O/c1-4-18-9-15-17-12(18)5-6-14-13(20)11-7-16-19(8-11)10(2)3/h7-10H,4-6H2,1-3H3,(H,14,20) |
| InChIKey | OKUWPUFTLYZMQS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-1-propan-2-ylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-1-propan-2-ylpyrazole-4-carboxamide?
The IUPAC name of N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-1-propan-2-ylpyrazole-4-carboxamide (CID 70769764) is N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-1-propan-2-ylpyrazole-4-carboxamide.
What is the SMILES notation for N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-1-propan-2-ylpyrazole-4-carboxamide?
The canonical SMILES for N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-1-propan-2-ylpyrazole-4-carboxamide is CCn1cnnc1CCNC(=O)c1cnn(C(C)C)c1.
What is the InChIKey of N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-1-propan-2-ylpyrazole-4-carboxamide?
The InChIKey is OKUWPUFTLYZMQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N6O/c1-4-18-9-15-17-12(18)5-6-14-13(20)11-7-16-19(8-11)10(2)3/h7-10H,4-6H2,1-3H3,(H,14,20).
What are the key properties of N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-1-propan-2-ylpyrazole-4-carboxamide?
N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-1-propan-2-ylpyrazole-4-carboxamide has a molecular weight of 276.34 g/mol, XLogP of 1.05, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-1-propan-2-ylpyrazole-4-carboxamide is sourced from PubChem (CID 70769764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).