C21H26N2O2 — CID 70770098
[(3aS,6aS)-3a-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(6-ethyl-2-methylquinolin-4-yl)methanone (PubChem CID 70770098) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is [(3aS,6aS)-3a-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(6-ethyl-2-methylquinolin-4-yl)methanone.
| Compound Name | [(3aS,6aS)-3a-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(6-ethyl-2-methylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 70770098 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | [(3aS,6aS)-3a-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(6-ethyl-2-methylquinolin-4-yl)methanone |
| SMILES | CCc1ccc2nc(C)cc(C(=O)N3C[C@H]4CCC[C@@]4(CO)C3)c2c1 |
| InChI | InChI=1S/C21H26N2O2/c1-3-15-6-7-19-17(10-15)18(9-14(2)22-19)20(25)23-11-16-5-4-8-21(16,12-23)13-24/h6-7,9-10,16,24H,3-5,8,11-13H2,1-2H3/t16-,21+/m1/s1 |
| InChIKey | OUNYHJKLDQMYST-IERDGZPVSA-N |
| XLogP | 3.34 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |