C17H28N6O — CID 70770142
3-[[5-[[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-1,1-dimethylurea (PubChem CID 70770142) has the molecular formula C17H28N6O and a molecular weight of 332.45 g/mol. Its IUPAC name is 3-[[5-[[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-1,1-dimethylurea.
| Compound Name | 3-[[5-[[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 70770142 |
| Molecular Formula | C17H28N6O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 3-[[5-[[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCc1cc2n(n1)CCCN(CC1[C@H]3CNC[C@@H]13)C2 |
| InChI | InChI=1S/C17H28N6O/c1-21(2)17(24)19-7-12-6-13-10-22(4-3-5-23(13)20-12)11-16-14-8-18-9-15(14)16/h6,14-16,18H,3-5,7-11H2,1-2H3,(H,19,24)/t14-,15+,16? |
| InChIKey | GHNRVQSVFDTDRY-XYPWUTKMSA-N |
| XLogP | 0.33 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |