C16H26N4O — CID 70770851
(2S,3S)-2-amino-3-methyl-N-[(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)methyl]pentanamide (PubChem CID 70770851) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-methyl-N-[(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)methyl]pentanamide.
| Compound Name | (2S,3S)-2-amino-3-methyl-N-[(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 70770851 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (2S,3S)-2-amino-3-methyl-N-[(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)methyl]pentanamide |
| SMILES | CC[C@H](C)[C@H](N)C(=O)NCc1c(C)ncc2c1CCNC2 |
| InChI | InChI=1S/C16H26N4O/c1-4-10(2)15(17)16(21)20-9-14-11(3)19-8-12-7-18-6-5-13(12)14/h8,10,15,18H,4-7,9,17H2,1-3H3,(H,20,21)/t10-,15-/m0/s1 |
| InChIKey | FPUXTZFOFKBLRP-BONVTDFDSA-N |
| XLogP | 1.03 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |