C12H24NO+ — CID 7077086
[(2S,6S)-6-methyl-4-methylideneoxan-2-yl]methyl-(2-methylpropyl)azanium (PubChem CID 7077086) has the molecular formula C12H24NO+ and a molecular weight of 198.33 g/mol. Its IUPAC name is [(2S,6S)-6-methyl-4-methylideneoxan-2-yl]methyl-(2-methylpropyl)azanium.
| Compound Name | [(2S,6S)-6-methyl-4-methylideneoxan-2-yl]methyl-(2-methylpropyl)azanium |
|---|---|
| PubChem CID | 7077086 |
| Molecular Formula | C12H24NO+ |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.19 |
| IUPAC Name | [(2S,6S)-6-methyl-4-methylideneoxan-2-yl]methyl-(2-methylpropyl)azanium |
| SMILES | C=C1C[C@@H](C[NH2+]CC(C)C)O[C@@H](C)C1 |
| InChI | InChI=1S/C12H23NO/c1-9(2)7-13-8-12-6-10(3)5-11(4)14-12/h9,11-13H,3,5-8H2,1-2,4H3/p+1/t11-,12-/m0/s1 |
| InChIKey | BJPVBGBVOJLXAK-RYUDHWBXSA-O |
| XLogP | 1.33 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|