C14H23F4N3O — CID 70771016
1-methyl-4-(3,3,4,4-tetrafluorobutyl)-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 70771016) has the molecular formula C14H23F4N3O and a molecular weight of 325.35 g/mol. Its IUPAC name is 1-methyl-4-(3,3,4,4-tetrafluorobutyl)-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | 1-methyl-4-(3,3,4,4-tetrafluorobutyl)-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 70771016 |
| Molecular Formula | C14H23F4N3O |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 1-methyl-4-(3,3,4,4-tetrafluorobutyl)-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | CN1CCN(CCC(F)(F)C(F)F)CC12CCNC(=O)CC2 |
| InChI | InChI=1S/C14H23F4N3O/c1-20-8-9-21(7-5-14(17,18)12(15)16)10-13(20)3-2-11(22)19-6-4-13/h12H,2-10H2,1H3,(H,19,22) |
| InChIKey | LMUHLDRVCMPFOL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|