C19H28N4O4 — CID 70771258
1-[2-[(4aS,8aR)-1-(3-methylbutyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-2-oxoethyl]pyrimidine-2,4-dione (PubChem CID 70771258) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-[2-[(4aS,8aR)-1-(3-methylbutyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-2-oxoethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-[(4aS,8aR)-1-(3-methylbutyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-2-oxoethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70771258 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 1-[2-[(4aS,8aR)-1-(3-methylbutyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-2-oxoethyl]pyrimidine-2,4-dione |
| SMILES | CC(C)CCN1C(=O)CC[C@H]2CN(C(=O)Cn3ccc(=O)[nH]c3=O)CC[C@H]21 |
| InChI | InChI=1S/C19H28N4O4/c1-13(2)5-10-23-15-6-8-21(11-14(15)3-4-17(23)25)18(26)12-22-9-7-16(24)20-19(22)27/h7,9,13-15H,3-6,8,10-12H2,1-2H3,(H,20,24,27)/t14-,15+/m0/s1 |
| InChIKey | HYZGWDPRJQVOBN-LSDHHAIUSA-N |
| XLogP | 0.42 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |