C20H28N2O3 — CID 7077157
(3R,3aS,5aS,9bS)-5a,9-dimethyl-3-[(4-methylpiperazin-1-yl)methyl]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione (PubChem CID 7077157) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is (3R,3aS,5aS,9bS)-5a,9-dimethyl-3-[(4-methylpiperazin-1-yl)methyl]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione.
| Compound Name | (3R,3aS,5aS,9bS)-5a,9-dimethyl-3-[(4-methylpiperazin-1-yl)methyl]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione |
|---|---|
| PubChem CID | 7077157 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (3R,3aS,5aS,9bS)-5a,9-dimethyl-3-[(4-methylpiperazin-1-yl)methyl]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione |
| SMILES | CC1=C2[C@H]3OC(=O)[C@@H](CN4CCN(C)CC4)[C@@H]3CC[C@@]2(C)C=CC1=O |
| InChI | InChI=1S/C20H28N2O3/c1-13-16(23)5-7-20(2)6-4-14-15(19(24)25-18(14)17(13)20)12-22-10-8-21(3)9-11-22/h5,7,14-15,18H,4,6,8-12H2,1-3H3/t14-,15-,18-,20-/m0/s1 |
| InChIKey | DCDLQZBEQQIOSL-OFVDUGFESA-N |
| XLogP | 1.65 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |