About N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide
N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide (PubChem CID 70771582) has the molecular formula C15H23N3O2S
and a molecular weight of 309.44 g/mol. Its IUPAC name is N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
| PubChem CID | 70771582 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
| SMILES | Cc1nc(CCNC(=O)C2CC(=O)N(C(C)C)C2)sc1C |
| InChI | InChI=1S/C15H23N3O2S/c1-9(2)18-8-12(7-14(18)19)15(20)16-6-5-13-17-10(3)11(4)21-13/h9,12H,5-8H2,1-4H3,(H,16,20) |
| InChIKey | VNWJREYPNXUOGB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide?
The IUPAC name of N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide (CID 70771582) is N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide.
What is the SMILES notation for N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide?
The canonical SMILES for N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide is Cc1nc(CCNC(=O)C2CC(=O)N(C(C)C)C2)sc1C.
What is the InChIKey of N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide?
The InChIKey is VNWJREYPNXUOGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O2S/c1-9(2)18-8-12(7-14(18)19)15(20)16-6-5-13-17-10(3)11(4)21-13/h9,12H,5-8H2,1-4H3,(H,16,20).
What are the key properties of N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide?
N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide has a molecular weight of 309.44 g/mol, XLogP of 1.68, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide is sourced from PubChem (CID 70771582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).