C17H21N5O3 — CID 70771730
3-N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]piperidine-1,3-dicarboxamide (PubChem CID 70771730) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 3-N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 70771730 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 3-N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)N1CCCC(C(=O)NCc2noc(Cc3ccccc3)n2)C1 |
| InChI | InChI=1S/C17H21N5O3/c18-17(24)22-8-4-7-13(11-22)16(23)19-10-14-20-15(25-21-14)9-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2,(H2,18,24)(H,19,23) |
| InChIKey | KONHDKAIEDOJRS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |