C17H23ClF2N2O — CID 70772381
[(3R,4R)-1-[(2-chloro-3,6-difluorophenyl)methyl]-4-(pyrrolidin-1-ylmethyl)pyrrolidin-3-yl]methanol (PubChem CID 70772381) has the molecular formula C17H23ClF2N2O and a molecular weight of 344.83 g/mol. Its IUPAC name is [(3R,4R)-1-[(2-chloro-3,6-difluorophenyl)methyl]-4-(pyrrolidin-1-ylmethyl)pyrrolidin-3-yl]methanol.
| Compound Name | [(3R,4R)-1-[(2-chloro-3,6-difluorophenyl)methyl]-4-(pyrrolidin-1-ylmethyl)pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 70772381 |
| Molecular Formula | C17H23ClF2N2O |
| Molecular Weight | 344.83 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | [(3R,4R)-1-[(2-chloro-3,6-difluorophenyl)methyl]-4-(pyrrolidin-1-ylmethyl)pyrrolidin-3-yl]methanol |
| SMILES | OC[C@H]1CN(Cc2c(F)ccc(F)c2Cl)C[C@H]1CN1CCCC1 |
| InChI | InChI=1S/C17H23ClF2N2O/c18-17-14(15(19)3-4-16(17)20)10-22-8-12(13(9-22)11-23)7-21-5-1-2-6-21/h3-4,12-13,23H,1-2,5-11H2/t12-,13-/m1/s1 |
| InChIKey | DPQKZTHIZVOTJE-CHWSQXEVSA-N |
| XLogP | 2.75 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.83 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|