C18H18O3 — CID 707724
7,9,10-trimethyl-1,2,3,4-tetrahydro-[1]benzofuro[6,5-c]isochromen-5-one (PubChem CID 707724) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 7,9,10-trimethyl-1,2,3,4-tetrahydro-[1]benzofuro[6,5-c]isochromen-5-one.
| Compound Name | 7,9,10-trimethyl-1,2,3,4-tetrahydro-[1]benzofuro[6,5-c]isochromen-5-one |
|---|---|
| PubChem CID | 707724 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 7,9,10-trimethyl-1,2,3,4-tetrahydro-[1]benzofuro[6,5-c]isochromen-5-one |
| SMILES | Cc1oc2c(C)c3oc(=O)c4c(c3cc2c1C)CCCC4 |
| InChI | InChI=1S/C18H18O3/c1-9-11(3)20-16-10(2)17-15(8-14(9)16)12-6-4-5-7-13(12)18(19)21-17/h8H,4-7H2,1-3H3 |
| InChIKey | NDGOZESCJJKBME-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|