C17H23N5O — CID 70772514
1-[3-(3-methylphenyl)piperidin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one (PubChem CID 70772514) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 1-[3-(3-methylphenyl)piperidin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one.
| Compound Name | 1-[3-(3-methylphenyl)piperidin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 70772514 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 1-[3-(3-methylphenyl)piperidin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one |
| SMILES | Cc1cccc(C2CCCN(C(=O)CCn3nnnc3C)C2)c1 |
| InChI | InChI=1S/C17H23N5O/c1-13-5-3-6-15(11-13)16-7-4-9-21(12-16)17(23)8-10-22-14(2)18-19-20-22/h3,5-6,11,16H,4,7-10,12H2,1-2H3 |
| InChIKey | NIQOFVUNCSZWHO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |