About [1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone
[1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone (PubChem CID 70772556) has the molecular formula C16H20N4O2S
and a molecular weight of 332.43 g/mol. Its IUPAC name is [1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone.
Molecular Properties
| Compound Name | [1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone |
| PubChem CID | 70772556 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | [1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone |
| SMILES | Cc1nc(C)c(C(=O)N2CCCC(C(=O)c3nccn3C)C2)s1 |
| InChI | InChI=1S/C16H20N4O2S/c1-10-14(23-11(2)18-10)16(22)20-7-4-5-12(9-20)13(21)15-17-6-8-19(15)3/h6,8,12H,4-5,7,9H2,1-3H3 |
| InChIKey | CWJAEKCJFCLSHS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone?
The IUPAC name of [1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone (CID 70772556) is [1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone.
What is the SMILES notation for [1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone?
The canonical SMILES for [1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone is Cc1nc(C)c(C(=O)N2CCCC(C(=O)c3nccn3C)C2)s1.
What is the InChIKey of [1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone?
The InChIKey is CWJAEKCJFCLSHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O2S/c1-10-14(23-11(2)18-10)16(22)20-7-4-5-12(9-20)13(21)15-17-6-8-19(15)3/h6,8,12H,4-5,7,9H2,1-3H3.
What are the key properties of [1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone?
[1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone has a molecular weight of 332.43 g/mol, XLogP of 2.23, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone is sourced from PubChem (CID 70772556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).