C18H27N7O2 — CID 70772632
1,10-dimethyl-4-[(2-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methyl]-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 70772632) has the molecular formula C18H27N7O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 1,10-dimethyl-4-[(2-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methyl]-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | 1,10-dimethyl-4-[(2-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methyl]-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 70772632 |
| Molecular Formula | C18H27N7O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 1,10-dimethyl-4-[(2-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methyl]-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | Cc1nc2nc(CN3CCN(C)C4(CCC(=O)N(C)CC4)C3)cc(=O)n2[nH]1 |
| InChI | InChI=1S/C18H27N7O2/c1-13-19-17-20-14(10-16(27)25(17)21-13)11-24-9-8-23(3)18(12-24)5-4-15(26)22(2)7-6-18/h10H,4-9,11-12H2,1-3H3,(H,19,20,21) |
| InChIKey | PVXQGEUQPYGJIK-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |