C16H28N6O2S — CID 70773247
N'-[4-[(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]pyrimidin-2-yl]-N,N,N'-trimethylpropane-1,3-diamine (PubChem CID 70773247) has the molecular formula C16H28N6O2S and a molecular weight of 368.51 g/mol. Its IUPAC name is N'-[4-[(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]pyrimidin-2-yl]-N,N,N'-trimethylpropane-1,3-diamine.
| Compound Name | N'-[4-[(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]pyrimidin-2-yl]-N,N,N'-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 70773247 |
| Molecular Formula | C16H28N6O2S |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N'-[4-[(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]pyrimidin-2-yl]-N,N,N'-trimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCN(C)c1nccc(N2CCN[C@H]3CS(=O)(=O)C[C@H]32)n1 |
| InChI | InChI=1S/C16H28N6O2S/c1-20(2)8-4-9-21(3)16-18-6-5-15(19-16)22-10-7-17-13-11-25(23,24)12-14(13)22/h5-6,13-14,17H,4,7-12H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | NQKZUOVGDDJZJQ-UONOGXRCSA-N |
| XLogP | -0.56 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |