About 7-fluoro-2-methyl-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]quinoline-4-carboxamide
7-fluoro-2-methyl-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]quinoline-4-carboxamide (PubChem CID 70773805) has the molecular formula C19H22FN3O3
and a molecular weight of 359.40 g/mol. Its IUPAC name is 7-fluoro-2-methyl-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]quinoline-4-carboxamide.
Molecular Properties
| Compound Name | 7-fluoro-2-methyl-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]quinoline-4-carboxamide |
| PubChem CID | 70773805 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 7-fluoro-2-methyl-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]quinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@H]2COC[C@@H]2N2CCOCC2)c2ccc(F)cc2n1 |
| InChI | InChI=1S/C19H22FN3O3/c1-12-8-15(14-3-2-13(20)9-16(14)21-12)19(24)22-17-10-26-11-18(17)23-4-6-25-7-5-23/h2-3,8-9,17-18H,4-7,10-11H2,1H3,(H,22,24)/t17-,18-/m0/s1 |
| InChIKey | OWINWABBPDVMRQ-ROUUACIJSA-N |
| XLogP | 1.51 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-fluoro-2-methyl-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2-methyl-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]quinoline-4-carboxamide?
The IUPAC name of 7-fluoro-2-methyl-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]quinoline-4-carboxamide (CID 70773805) is 7-fluoro-2-methyl-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]quinoline-4-carboxamide.
What is the SMILES notation for 7-fluoro-2-methyl-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]quinoline-4-carboxamide?
The canonical SMILES for 7-fluoro-2-methyl-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]quinoline-4-carboxamide is Cc1cc(C(=O)N[C@H]2COC[C@@H]2N2CCOCC2)c2ccc(F)cc2n1.
What is the InChIKey of 7-fluoro-2-methyl-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]quinoline-4-carboxamide?
The InChIKey is OWINWABBPDVMRQ-ROUUACIJSA-N. The full InChI is InChI=1S/C19H22FN3O3/c1-12-8-15(14-3-2-13(20)9-16(14)21-12)19(24)22-17-10-26-11-18(17)23-4-6-25-7-5-23/h2-3,8-9,17-18H,4-7,10-11H2,1H3,(H,22,24)/t17-,18-/m0/s1.
What are the key properties of 7-fluoro-2-methyl-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]quinoline-4-carboxamide?
7-fluoro-2-methyl-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]quinoline-4-carboxamide has a molecular weight of 359.40 g/mol, XLogP of 1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2-methyl-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]quinoline-4-carboxamide is sourced from PubChem (CID 70773805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).