C18H24N4O4 — CID 70774111
2-[4-[(4-methoxyphenyl)methyl]-3-oxopiperazine-1-carbonyl]pyrrolidine-1-carboxamide (PubChem CID 70774111) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-[4-[(4-methoxyphenyl)methyl]-3-oxopiperazine-1-carbonyl]pyrrolidine-1-carboxamide.
| Compound Name | 2-[4-[(4-methoxyphenyl)methyl]-3-oxopiperazine-1-carbonyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 70774111 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-[4-[(4-methoxyphenyl)methyl]-3-oxopiperazine-1-carbonyl]pyrrolidine-1-carboxamide |
| SMILES | COc1ccc(CN2CCN(C(=O)C3CCCN3C(N)=O)CC2=O)cc1 |
| InChI | InChI=1S/C18H24N4O4/c1-26-14-6-4-13(5-7-14)11-20-9-10-21(12-16(20)23)17(24)15-3-2-8-22(15)18(19)25/h4-7,15H,2-3,8-12H2,1H3,(H2,19,25) |
| InChIKey | GTVUYMLPSQRYRQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |