C20H29N3O3 — CID 70776392
butyl 3-oxo-2-(pyridin-2-ylmethyl)-2,8-diazaspiro[5.5]undecane-8-carboxylate (PubChem CID 70776392) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is butyl 3-oxo-2-(pyridin-2-ylmethyl)-2,8-diazaspiro[5.5]undecane-8-carboxylate.
| Compound Name | butyl 3-oxo-2-(pyridin-2-ylmethyl)-2,8-diazaspiro[5.5]undecane-8-carboxylate |
|---|---|
| PubChem CID | 70776392 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | butyl 3-oxo-2-(pyridin-2-ylmethyl)-2,8-diazaspiro[5.5]undecane-8-carboxylate |
| SMILES | CCCCOC(=O)N1CCCC2(CCC(=O)N(Cc3ccccn3)C2)C1 |
| InChI | InChI=1S/C20H29N3O3/c1-2-3-13-26-19(25)22-12-6-9-20(15-22)10-8-18(24)23(16-20)14-17-7-4-5-11-21-17/h4-5,7,11H,2-3,6,8-10,12-16H2,1H3 |
| InChIKey | XRYPZROPNCIXFZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|