About 3-[[(5-benzyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]piperidin-3-ol
3-[[(5-benzyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]piperidin-3-ol (PubChem CID 70776784) has the molecular formula C16H22N4O2
and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-[[(5-benzyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]piperidin-3-ol.
Molecular Properties
| Compound Name | 3-[[(5-benzyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]piperidin-3-ol |
| PubChem CID | 70776784 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 3-[[(5-benzyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]piperidin-3-ol |
| SMILES | OC1(CNCc2noc(Cc3ccccc3)n2)CCCNC1 |
| InChI | InChI=1S/C16H22N4O2/c21-16(7-4-8-17-11-16)12-18-10-14-19-15(22-20-14)9-13-5-2-1-3-6-13/h1-3,5-6,17-18,21H,4,7-12H2 |
| InChIKey | ZVVSELFFZJURIL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[(5-benzyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]piperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(5-benzyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]piperidin-3-ol?
The IUPAC name of 3-[[(5-benzyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]piperidin-3-ol (CID 70776784) is 3-[[(5-benzyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]piperidin-3-ol.
What is the SMILES notation for 3-[[(5-benzyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]piperidin-3-ol?
The canonical SMILES for 3-[[(5-benzyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]piperidin-3-ol is OC1(CNCc2noc(Cc3ccccc3)n2)CCCNC1.
What is the InChIKey of 3-[[(5-benzyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]piperidin-3-ol?
The InChIKey is ZVVSELFFZJURIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O2/c21-16(7-4-8-17-11-16)12-18-10-14-19-15(22-20-14)9-13-5-2-1-3-6-13/h1-3,5-6,17-18,21H,4,7-12H2.
What are the key properties of 3-[[(5-benzyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]piperidin-3-ol?
3-[[(5-benzyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]piperidin-3-ol has a molecular weight of 302.38 g/mol, XLogP of 0.86, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(5-benzyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]piperidin-3-ol is sourced from PubChem (CID 70776784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).