C17H23N5O — CID 70777559
2-[3-[1-(cyclopropylmethyl)imidazol-2-yl]piperidin-1-yl]-5-methoxypyrimidine (PubChem CID 70777559) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 2-[3-[1-(cyclopropylmethyl)imidazol-2-yl]piperidin-1-yl]-5-methoxypyrimidine.
| Compound Name | 2-[3-[1-(cyclopropylmethyl)imidazol-2-yl]piperidin-1-yl]-5-methoxypyrimidine |
|---|---|
| PubChem CID | 70777559 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 2-[3-[1-(cyclopropylmethyl)imidazol-2-yl]piperidin-1-yl]-5-methoxypyrimidine |
| SMILES | COc1cnc(N2CCCC(c3nccn3CC3CC3)C2)nc1 |
| InChI | InChI=1S/C17H23N5O/c1-23-15-9-19-17(20-10-15)22-7-2-3-14(12-22)16-18-6-8-21(16)11-13-4-5-13/h6,8-10,13-14H,2-5,7,11-12H2,1H3 |
| InChIKey | LORYPLRYVFLTDU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |