C17H32FN3O2 — CID 70777697
4-(4-fluorobutyl)-10-(2-methoxyethyl)-1-methyl-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 70777697) has the molecular formula C17H32FN3O2 and a molecular weight of 329.46 g/mol. Its IUPAC name is 4-(4-fluorobutyl)-10-(2-methoxyethyl)-1-methyl-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | 4-(4-fluorobutyl)-10-(2-methoxyethyl)-1-methyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 70777697 |
| Molecular Formula | C17H32FN3O2 |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | 4-(4-fluorobutyl)-10-(2-methoxyethyl)-1-methyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | COCCN1CCC2(CCC1=O)CN(CCCCF)CCN2C |
| InChI | InChI=1S/C17H32FN3O2/c1-19-11-12-20(9-4-3-8-18)15-17(19)6-5-16(22)21(10-7-17)13-14-23-2/h3-15H2,1-2H3 |
| InChIKey | BVQVOWFOAYZANG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|