C17H27N5O4 — CID 70777944
(4aS,8aR)-6-(2-aminopyrimidin-4-yl)-1-[2-(2-hydroxyethoxy)ethyl]-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridine-4a-carboxylic acid (PubChem CID 70777944) has the molecular formula C17H27N5O4 and a molecular weight of 365.43 g/mol. Its IUPAC name is (4aS,8aR)-6-(2-aminopyrimidin-4-yl)-1-[2-(2-hydroxyethoxy)ethyl]-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridine-4a-carboxylic acid.
| Compound Name | (4aS,8aR)-6-(2-aminopyrimidin-4-yl)-1-[2-(2-hydroxyethoxy)ethyl]-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridine-4a-carboxylic acid |
|---|---|
| PubChem CID | 70777944 |
| Molecular Formula | C17H27N5O4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (4aS,8aR)-6-(2-aminopyrimidin-4-yl)-1-[2-(2-hydroxyethoxy)ethyl]-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridine-4a-carboxylic acid |
| SMILES | Nc1nccc(N2CC[C@H]3N(CCOCCO)CCC[C@]3(C(=O)O)C2)n1 |
| InChI | InChI=1S/C17H27N5O4/c18-16-19-5-2-14(20-16)22-7-3-13-17(12-22,15(24)25)4-1-6-21(13)8-10-26-11-9-23/h2,5,13,23H,1,3-4,6-12H2,(H,24,25)(H2,18,19,20)/t13-,17+/m1/s1 |
| InChIKey | ORHUYHRSUGAEDQ-DYVFJYSZSA-N |
| XLogP | -0.19 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|