C17H31N5O — CID 70778037
1-tert-butyl-3-[[5-(2-methylpropyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]urea (PubChem CID 70778037) has the molecular formula C17H31N5O and a molecular weight of 321.47 g/mol. Its IUPAC name is 1-tert-butyl-3-[[5-(2-methylpropyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]urea.
| Compound Name | 1-tert-butyl-3-[[5-(2-methylpropyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 70778037 |
| Molecular Formula | C17H31N5O |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | 1-tert-butyl-3-[[5-(2-methylpropyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]urea |
| SMILES | CC(C)CN1CCCn2nc(CNC(=O)NC(C)(C)C)cc2C1 |
| InChI | InChI=1S/C17H31N5O/c1-13(2)11-21-7-6-8-22-15(12-21)9-14(20-22)10-18-16(23)19-17(3,4)5/h9,13H,6-8,10-12H2,1-5H3,(H2,18,19,23) |
| InChIKey | WSBIIEWHVWXAPV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |