C19H21N3O3S — CID 70778095
6-methoxy-2-oxo-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-3,4-dihydro-1H-quinoline-4-carboxamide (PubChem CID 70778095) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 6-methoxy-2-oxo-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-3,4-dihydro-1H-quinoline-4-carboxamide.
| Compound Name | 6-methoxy-2-oxo-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-3,4-dihydro-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 70778095 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 6-methoxy-2-oxo-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-3,4-dihydro-1H-quinoline-4-carboxamide |
| SMILES | COc1ccc2c(c1)C(C(=O)NCc1nc3c(s1)CCCC3)CC(=O)N2 |
| InChI | InChI=1S/C19H21N3O3S/c1-25-11-6-7-14-12(8-11)13(9-17(23)21-14)19(24)20-10-18-22-15-4-2-3-5-16(15)26-18/h6-8,13H,2-5,9-10H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | CFSOCAUEBIXVSH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |