About 6-[[3-(3,5-dimethylpyrazol-1-yl)propyl-methylamino]methyl]-1,4-oxazepan-6-ol
6-[[3-(3,5-dimethylpyrazol-1-yl)propyl-methylamino]methyl]-1,4-oxazepan-6-ol (PubChem CID 70778236) has the molecular formula C15H28N4O2
and a molecular weight of 296.41 g/mol. Its IUPAC name is 6-[[3-(3,5-dimethylpyrazol-1-yl)propyl-methylamino]methyl]-1,4-oxazepan-6-ol.
Molecular Properties
| Compound Name | 6-[[3-(3,5-dimethylpyrazol-1-yl)propyl-methylamino]methyl]-1,4-oxazepan-6-ol |
| PubChem CID | 70778236 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 6-[[3-(3,5-dimethylpyrazol-1-yl)propyl-methylamino]methyl]-1,4-oxazepan-6-ol |
| SMILES | Cc1cc(C)n(CCCN(C)CC2(O)CNCCOC2)n1 |
| InChI | InChI=1S/C15H28N4O2/c1-13-9-14(2)19(17-13)7-4-6-18(3)11-15(20)10-16-5-8-21-12-15/h9,16,20H,4-8,10-12H2,1-3H3 |
| InChIKey | ZGPWGVRJRAKNTO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[[3-(3,5-dimethylpyrazol-1-yl)propyl-methylamino]methyl]-1,4-oxazepan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[3-(3,5-dimethylpyrazol-1-yl)propyl-methylamino]methyl]-1,4-oxazepan-6-ol?
The IUPAC name of 6-[[3-(3,5-dimethylpyrazol-1-yl)propyl-methylamino]methyl]-1,4-oxazepan-6-ol (CID 70778236) is 6-[[3-(3,5-dimethylpyrazol-1-yl)propyl-methylamino]methyl]-1,4-oxazepan-6-ol.
What is the SMILES notation for 6-[[3-(3,5-dimethylpyrazol-1-yl)propyl-methylamino]methyl]-1,4-oxazepan-6-ol?
The canonical SMILES for 6-[[3-(3,5-dimethylpyrazol-1-yl)propyl-methylamino]methyl]-1,4-oxazepan-6-ol is Cc1cc(C)n(CCCN(C)CC2(O)CNCCOC2)n1.
What is the InChIKey of 6-[[3-(3,5-dimethylpyrazol-1-yl)propyl-methylamino]methyl]-1,4-oxazepan-6-ol?
The InChIKey is ZGPWGVRJRAKNTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N4O2/c1-13-9-14(2)19(17-13)7-4-6-18(3)11-15(20)10-16-5-8-21-12-15/h9,16,20H,4-8,10-12H2,1-3H3.
What are the key properties of 6-[[3-(3,5-dimethylpyrazol-1-yl)propyl-methylamino]methyl]-1,4-oxazepan-6-ol?
6-[[3-(3,5-dimethylpyrazol-1-yl)propyl-methylamino]methyl]-1,4-oxazepan-6-ol has a molecular weight of 296.41 g/mol, XLogP of 0.17, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[3-(3,5-dimethylpyrazol-1-yl)propyl-methylamino]methyl]-1,4-oxazepan-6-ol is sourced from PubChem (CID 70778236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).