C20H20NO6+ — CID 7077860
1,3,8-trihydroxy-6-methyl-2-(morpholin-4-ium-4-ylmethyl)anthracene-9,10-dione (PubChem CID 7077860) has the molecular formula C20H20NO6+ and a molecular weight of 370.38 g/mol. Its IUPAC name is 1,3,8-trihydroxy-6-methyl-2-(morpholin-4-ium-4-ylmethyl)anthracene-9,10-dione.
| Compound Name | 1,3,8-trihydroxy-6-methyl-2-(morpholin-4-ium-4-ylmethyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 7077860 |
| Molecular Formula | C20H20NO6+ |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1,3,8-trihydroxy-6-methyl-2-(morpholin-4-ium-4-ylmethyl)anthracene-9,10-dione |
| SMILES | Cc1cc(O)c2c(c1)C(=O)c1cc(O)c(C[NH+]3CCOCC3)c(O)c1C2=O |
| InChI | InChI=1S/C20H19NO6/c1-10-6-11-16(15(23)7-10)20(26)17-12(18(11)24)8-14(22)13(19(17)25)9-21-2-4-27-5-3-21/h6-8,22-23,25H,2-5,9H2,1H3/p+1 |
| InChIKey | QVBDDUUMJXGCIF-UHFFFAOYSA-O |
| XLogP | 0.30 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|