C15H22N4O3S — CID 70778959
[(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(4-methylpyrimidin-5-yl)methanone (PubChem CID 70778959) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is [(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(4-methylpyrimidin-5-yl)methanone.
| Compound Name | [(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(4-methylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 70778959 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | [(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(4-methylpyrimidin-5-yl)methanone |
| SMILES | CCCN1CCN(C(=O)c2cncnc2C)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C15H22N4O3S/c1-3-4-18-5-6-19(14-9-23(21,22)8-13(14)18)15(20)12-7-16-10-17-11(12)2/h7,10,13-14H,3-6,8-9H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | AUGQJCQPNBMMAC-KGLIPLIRSA-N |
| XLogP | 0.12 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |